2-{5,6-dichloro-2-[(2-fluorophenyl)methyl]-1H-benzimidazol-1-yl}-N-propylpentanamide
Chemical Structure Depiction of
2-{5,6-dichloro-2-[(2-fluorophenyl)methyl]-1H-benzimidazol-1-yl}-N-propylpentanamide
2-{5,6-dichloro-2-[(2-fluorophenyl)methyl]-1H-benzimidazol-1-yl}-N-propylpentanamide
Compound characteristics
| Compound ID: | V003-3544 |
| Compound Name: | 2-{5,6-dichloro-2-[(2-fluorophenyl)methyl]-1H-benzimidazol-1-yl}-N-propylpentanamide |
| Molecular Weight: | 436.36 |
| Molecular Formula: | C22 H24 Cl2 F N3 O |
| Salt: | not_available |
| Smiles: | CCCC(C(NCCC)=O)n1c2cc(c(cc2nc1Cc1ccccc1F)[Cl])[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.36 |
| logD: | 6.3598 |
| logSw: | -6.162 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.95 |
| InChI Key: | MJLLHDJXHCLNRZ-IBGZPJMESA-N |