N-ethyl-4-{5-[(2-fluorophenyl)methyl]-6-methyl-2-(propan-2-yl)pyrimidin-4-yl}piperazine-1-carboxamide
Chemical Structure Depiction of
N-ethyl-4-{5-[(2-fluorophenyl)methyl]-6-methyl-2-(propan-2-yl)pyrimidin-4-yl}piperazine-1-carboxamide
N-ethyl-4-{5-[(2-fluorophenyl)methyl]-6-methyl-2-(propan-2-yl)pyrimidin-4-yl}piperazine-1-carboxamide
Compound characteristics
| Compound ID: | V003-3565 |
| Compound Name: | N-ethyl-4-{5-[(2-fluorophenyl)methyl]-6-methyl-2-(propan-2-yl)pyrimidin-4-yl}piperazine-1-carboxamide |
| Molecular Weight: | 399.51 |
| Molecular Formula: | C22 H30 F N5 O |
| Salt: | not_available |
| Smiles: | CCNC(N1CCN(CC1)c1c(Cc2ccccc2F)c(C)nc(C(C)C)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2986 |
| logD: | 4.2533 |
| logSw: | -4.2107 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.997 |
| InChI Key: | NORNFFCYNLONFJ-UHFFFAOYSA-N |