1-(4-{5-[(3-chlorophenyl)methyl]-2-cyclopropyl-6-ethylpyrimidin-4-yl}piperazin-1-yl)ethan-1-one
Chemical Structure Depiction of
1-(4-{5-[(3-chlorophenyl)methyl]-2-cyclopropyl-6-ethylpyrimidin-4-yl}piperazin-1-yl)ethan-1-one
1-(4-{5-[(3-chlorophenyl)methyl]-2-cyclopropyl-6-ethylpyrimidin-4-yl}piperazin-1-yl)ethan-1-one
Compound characteristics
| Compound ID: | V003-3610 |
| Compound Name: | 1-(4-{5-[(3-chlorophenyl)methyl]-2-cyclopropyl-6-ethylpyrimidin-4-yl}piperazin-1-yl)ethan-1-one |
| Molecular Weight: | 398.93 |
| Molecular Formula: | C22 H27 Cl N4 O |
| Smiles: | CCc1c(Cc2cccc(c2)[Cl])c(nc(C2CC2)n1)N1CCN(CC1)C(C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0912 |
| logD: | 4.0051 |
| logSw: | -5.2367 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 40.636 |
| InChI Key: | MGYXIPJLYYKONY-UHFFFAOYSA-N |