N-({2-(dimethylamino)-5-[(propan-2-yl)carbamamido]phenyl}methyl)-2-methyl-N-(1-phenylethyl)propanamide
Chemical Structure Depiction of
N-({2-(dimethylamino)-5-[(propan-2-yl)carbamamido]phenyl}methyl)-2-methyl-N-(1-phenylethyl)propanamide
N-({2-(dimethylamino)-5-[(propan-2-yl)carbamamido]phenyl}methyl)-2-methyl-N-(1-phenylethyl)propanamide
Compound characteristics
| Compound ID: | V003-3849 |
| Compound Name: | N-({2-(dimethylamino)-5-[(propan-2-yl)carbamamido]phenyl}methyl)-2-methyl-N-(1-phenylethyl)propanamide |
| Molecular Weight: | 424.59 |
| Molecular Formula: | C25 H36 N4 O2 |
| Salt: | not_available |
| Smiles: | CC(C)C(N(Cc1cc(ccc1N(C)C)NC(NC(C)C)=O)C(C)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8816 |
| logD: | 4.8798 |
| logSw: | -4.5039 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.188 |
| InChI Key: | YEVYGLZXEFQFKR-IBGZPJMESA-N |