N-{4-[3-(4-tert-butylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}-3-methoxybenzamide
Chemical Structure Depiction of
N-{4-[3-(4-tert-butylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}-3-methoxybenzamide
N-{4-[3-(4-tert-butylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}-3-methoxybenzamide
Compound characteristics
| Compound ID: | V003-3893 |
| Compound Name: | N-{4-[3-(4-tert-butylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}-3-methoxybenzamide |
| Molecular Weight: | 460.59 |
| Molecular Formula: | C27 H28 N2 O3 S |
| Smiles: | CC(C)(C)c1ccc(cc1)N1C(c2ccc(cc2)NC(c2cccc(c2)OC)=O)SCC1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.9446 |
| logD: | 5.9446 |
| logSw: | -5.5796 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.768 |
| InChI Key: | INIOTYDZYYWWRQ-SANMLTNESA-N |