(4-{2-(butan-2-yl)-5-[(2,5-dimethylphenyl)methyl]-6-methylpyrimidin-4-yl}piperazin-1-yl)(cyclobutyl)methanone
					Chemical Structure Depiction of
(4-{2-(butan-2-yl)-5-[(2,5-dimethylphenyl)methyl]-6-methylpyrimidin-4-yl}piperazin-1-yl)(cyclobutyl)methanone
			(4-{2-(butan-2-yl)-5-[(2,5-dimethylphenyl)methyl]-6-methylpyrimidin-4-yl}piperazin-1-yl)(cyclobutyl)methanone
Compound characteristics
| Compound ID: | V003-3922 | 
| Compound Name: | (4-{2-(butan-2-yl)-5-[(2,5-dimethylphenyl)methyl]-6-methylpyrimidin-4-yl}piperazin-1-yl)(cyclobutyl)methanone | 
| Molecular Weight: | 434.63 | 
| Molecular Formula: | C27 H38 N4 O | 
| Salt: | not_available | 
| Smiles: | CCC(C)c1nc(C)c(Cc2cc(C)ccc2C)c(n1)N1CCN(CC1)C(C1CCC1)=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 6.124 | 
| logD: | 5.563 | 
| logSw: | -5.2799 | 
| Hydrogen bond acceptors count: | 4 | 
| Polar surface area: | 39.48 | 
| InChI Key: | CIFFNTQLRCOLKA-IBGZPJMESA-N | 
 
				 
				