1-{2-methyl-4-[7-(trifluoromethyl)dibenzo[b,f][1,4]oxazepin-11-yl]piperazin-1-yl}-2-phenoxyethan-1-one
Chemical Structure Depiction of
1-{2-methyl-4-[7-(trifluoromethyl)dibenzo[b,f][1,4]oxazepin-11-yl]piperazin-1-yl}-2-phenoxyethan-1-one
1-{2-methyl-4-[7-(trifluoromethyl)dibenzo[b,f][1,4]oxazepin-11-yl]piperazin-1-yl}-2-phenoxyethan-1-one
Compound characteristics
| Compound ID: | V003-4173 |
| Compound Name: | 1-{2-methyl-4-[7-(trifluoromethyl)dibenzo[b,f][1,4]oxazepin-11-yl]piperazin-1-yl}-2-phenoxyethan-1-one |
| Molecular Weight: | 495.5 |
| Molecular Formula: | C27 H24 F3 N3 O3 |
| Salt: | not_available |
| Smiles: | CC1CN(CCN1C(COc1ccccc1)=O)C1c2ccccc2Oc2cc(ccc2N=1)C(F)(F)F |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9284 |
| logD: | 4.4128 |
| logSw: | -4.588 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 40.908 |
| InChI Key: | LAFQZPRDHRKOQM-SFHVURJKSA-N |