N-(2-{[1-(3-chloro-4-fluorophenyl)-4-(4-chlorophenyl)-1H-imidazol-2-yl]amino}-2-oxoethyl)-2-fluoro-N-(2-methylpropyl)benzamide
Chemical Structure Depiction of
N-(2-{[1-(3-chloro-4-fluorophenyl)-4-(4-chlorophenyl)-1H-imidazol-2-yl]amino}-2-oxoethyl)-2-fluoro-N-(2-methylpropyl)benzamide
N-(2-{[1-(3-chloro-4-fluorophenyl)-4-(4-chlorophenyl)-1H-imidazol-2-yl]amino}-2-oxoethyl)-2-fluoro-N-(2-methylpropyl)benzamide
Compound characteristics
| Compound ID: | V003-4840 |
| Compound Name: | N-(2-{[1-(3-chloro-4-fluorophenyl)-4-(4-chlorophenyl)-1H-imidazol-2-yl]amino}-2-oxoethyl)-2-fluoro-N-(2-methylpropyl)benzamide |
| Molecular Weight: | 557.43 |
| Molecular Formula: | C28 H24 Cl2 F2 N4 O2 |
| Salt: | not_available |
| Smiles: | CC(C)CN(CC(Nc1nc(cn1c1ccc(c(c1)[Cl])F)c1ccc(cc1)[Cl])=O)C(c1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 7.0853 |
| logD: | 7.0853 |
| logSw: | -6.2539 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.664 |
| InChI Key: | OYSZRVMSLPITOR-UHFFFAOYSA-N |