N-(2-{4-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-3-methoxy-N-(2-methoxyethyl)benzamide
Chemical Structure Depiction of
N-(2-{4-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-3-methoxy-N-(2-methoxyethyl)benzamide
N-(2-{4-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-3-methoxy-N-(2-methoxyethyl)benzamide
Compound characteristics
| Compound ID: | V003-4854 |
| Compound Name: | N-(2-{4-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-3-methoxy-N-(2-methoxyethyl)benzamide |
| Molecular Weight: | 549.63 |
| Molecular Formula: | C29 H35 N5 O6 |
| Salt: | not_available |
| Smiles: | COCCN(CC(N1CCN(CC1)c1ccc(c2ccc(c(c2)OC)OC)nn1)=O)C(c1cccc(c1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0763 |
| logD: | 2.0036 |
| logSw: | -2.5791 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 88.163 |
| InChI Key: | DTLNWDWTWPTKFX-UHFFFAOYSA-N |