1-{2-[bis(4-fluorophenyl)methoxy]ethyl}-4-(4-propylbenzene-1-sulfonyl)piperazine
Chemical Structure Depiction of
1-{2-[bis(4-fluorophenyl)methoxy]ethyl}-4-(4-propylbenzene-1-sulfonyl)piperazine
1-{2-[bis(4-fluorophenyl)methoxy]ethyl}-4-(4-propylbenzene-1-sulfonyl)piperazine
Compound characteristics
| Compound ID: | V003-5024 |
| Compound Name: | 1-{2-[bis(4-fluorophenyl)methoxy]ethyl}-4-(4-propylbenzene-1-sulfonyl)piperazine |
| Molecular Weight: | 514.63 |
| Molecular Formula: | C28 H32 F2 N2 O3 S |
| Salt: | not_available |
| Smiles: | CCCc1ccc(cc1)S(N1CCN(CC1)CCOC(c1ccc(cc1)F)c1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.896 |
| logD: | 5.8889 |
| logSw: | -5.6114 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 42.371 |
| InChI Key: | PNKXBHOGUPFKIP-UHFFFAOYSA-N |