N-{2-ethyl-4-[2-(4-fluorophenyl)ethyl]-3-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl}-2,6-dimethoxybenzamide
Chemical Structure Depiction of
N-{2-ethyl-4-[2-(4-fluorophenyl)ethyl]-3-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl}-2,6-dimethoxybenzamide
N-{2-ethyl-4-[2-(4-fluorophenyl)ethyl]-3-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl}-2,6-dimethoxybenzamide
Compound characteristics
| Compound ID: | V003-5207 |
| Compound Name: | N-{2-ethyl-4-[2-(4-fluorophenyl)ethyl]-3-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl}-2,6-dimethoxybenzamide |
| Molecular Weight: | 492.55 |
| Molecular Formula: | C28 H29 F N2 O5 |
| Smiles: | CCC1C(N(CCc2ccc(cc2)F)Cc2cc(ccc2O1)NC(c1c(cccc1OC)OC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3702 |
| logD: | 4.311 |
| logSw: | -4.4381 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.106 |
| InChI Key: | CKBDMGXARYEYNR-QFIPXVFZSA-N |