N-{3-[5-(3-fluorophenyl)-3-(2-methoxyethoxy)-1H-1,2,4-triazol-1-yl]phenyl}-4-methoxy-3-(trifluoromethyl)benzamide
Chemical Structure Depiction of
N-{3-[5-(3-fluorophenyl)-3-(2-methoxyethoxy)-1H-1,2,4-triazol-1-yl]phenyl}-4-methoxy-3-(trifluoromethyl)benzamide
N-{3-[5-(3-fluorophenyl)-3-(2-methoxyethoxy)-1H-1,2,4-triazol-1-yl]phenyl}-4-methoxy-3-(trifluoromethyl)benzamide
Compound characteristics
| Compound ID: | V003-5326 |
| Compound Name: | N-{3-[5-(3-fluorophenyl)-3-(2-methoxyethoxy)-1H-1,2,4-triazol-1-yl]phenyl}-4-methoxy-3-(trifluoromethyl)benzamide |
| Molecular Weight: | 530.48 |
| Molecular Formula: | C26 H22 F4 N4 O4 |
| Salt: | not_available |
| Smiles: | COCCOc1nc(c2cccc(c2)F)n(c2cccc(c2)NC(c2ccc(c(c2)C(F)(F)F)OC)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.2864 |
| logD: | 5.2864 |
| logSw: | -5.3998 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.172 |
| InChI Key: | MKIPFRCWZSHFLS-UHFFFAOYSA-N |