1-(2-methylbenzoyl)-N-(3-methylbutyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide
Chemical Structure Depiction of
1-(2-methylbenzoyl)-N-(3-methylbutyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide
1-(2-methylbenzoyl)-N-(3-methylbutyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide
Compound characteristics
| Compound ID: | V003-5478 |
| Compound Name: | 1-(2-methylbenzoyl)-N-(3-methylbutyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide |
| Molecular Weight: | 392.54 |
| Molecular Formula: | C25 H32 N2 O2 |
| Smiles: | CC(C)CCNC(C1CN(CC1c1ccccc1C)C(c1ccccc1C)=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.5269 |
| logD: | 4.5269 |
| logSw: | -4.2785 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.374 |
| InChI Key: | HUIZWIMFJUPQQI-UHFFFAOYSA-N |