4-methoxy-N-(2-{4-[6-(4-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-N-(1-phenylethyl)benzamide
Chemical Structure Depiction of
4-methoxy-N-(2-{4-[6-(4-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-N-(1-phenylethyl)benzamide
4-methoxy-N-(2-{4-[6-(4-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-N-(1-phenylethyl)benzamide
Compound characteristics
| Compound ID: | V003-5742 |
| Compound Name: | 4-methoxy-N-(2-{4-[6-(4-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-N-(1-phenylethyl)benzamide |
| Molecular Weight: | 565.67 |
| Molecular Formula: | C33 H35 N5 O4 |
| Salt: | not_available |
| Smiles: | CC(c1ccccc1)N(CC(N1CCN(CC1)c1ccc(c2ccc(cc2)OC)nn1)=O)C(c1ccc(cc1)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8628 |
| logD: | 4.8605 |
| logSw: | -4.5722 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 71.217 |
| InChI Key: | PJASQZQQOCDWEY-DEOSSOPVSA-N |