1-([(4-fluorophenyl)methyl]{[5-(2-methoxyphenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}amino)hex-5-en-2-ol
Chemical Structure Depiction of
1-([(4-fluorophenyl)methyl]{[5-(2-methoxyphenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}amino)hex-5-en-2-ol
1-([(4-fluorophenyl)methyl]{[5-(2-methoxyphenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}amino)hex-5-en-2-ol
Compound characteristics
| Compound ID: | V003-5801 |
| Compound Name: | 1-([(4-fluorophenyl)methyl]{[5-(2-methoxyphenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}amino)hex-5-en-2-ol |
| Molecular Weight: | 515.63 |
| Molecular Formula: | C31 H34 F N3 O3 |
| Salt: | not_available |
| Smiles: | Cc1c(CN(CC(CCC=C)O)Cc2ccc(cc2)F)c(n(c2ccccc2)n1)Oc1ccccc1OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.9927 |
| logD: | 5.2061 |
| logSw: | -5.7247 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.968 |
| InChI Key: | AIEVBJOHESDJOV-MHZLTWQESA-N |