2-(2-benzyl-5,6-dichloro-1H-benzimidazol-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide
Chemical Structure Depiction of
2-(2-benzyl-5,6-dichloro-1H-benzimidazol-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide
2-(2-benzyl-5,6-dichloro-1H-benzimidazol-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide
Compound characteristics
| Compound ID: | V003-6152 |
| Compound Name: | 2-(2-benzyl-5,6-dichloro-1H-benzimidazol-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
| Molecular Weight: | 498.41 |
| Molecular Formula: | C26 H25 Cl2 N3 O3 |
| Salt: | not_available |
| Smiles: | COc1ccc(CCNC(Cn2c3cc(c(cc3nc2Cc2ccccc2)[Cl])[Cl])=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 4.9462 |
| logD: | 4.9364 |
| logSw: | -5.0808 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.445 |
| InChI Key: | OMEMHUOHSXZWGM-UHFFFAOYSA-N |