(4-{5-[(3-chlorophenyl)methyl]-6-ethyl-2-(propan-2-yl)pyrimidin-4-yl}piperazin-1-yl)(thiophen-2-yl)methanone
Chemical Structure Depiction of
(4-{5-[(3-chlorophenyl)methyl]-6-ethyl-2-(propan-2-yl)pyrimidin-4-yl}piperazin-1-yl)(thiophen-2-yl)methanone
(4-{5-[(3-chlorophenyl)methyl]-6-ethyl-2-(propan-2-yl)pyrimidin-4-yl}piperazin-1-yl)(thiophen-2-yl)methanone
Compound characteristics
| Compound ID: | V003-6240 |
| Compound Name: | (4-{5-[(3-chlorophenyl)methyl]-6-ethyl-2-(propan-2-yl)pyrimidin-4-yl}piperazin-1-yl)(thiophen-2-yl)methanone |
| Molecular Weight: | 469.05 |
| Molecular Formula: | C25 H29 Cl N4 O S |
| Salt: | not_available |
| Smiles: | CCc1c(Cc2cccc(c2)[Cl])c(nc(C(C)C)n1)N1CCN(CC1)C(c1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.4749 |
| logD: | 6.3108 |
| logSw: | -6.2005 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 40.664 |
| InChI Key: | ASDATMREPAIVEY-UHFFFAOYSA-N |