N-[2-(3-chlorophenyl)ethyl]-5-(4-ethoxyphenyl)thiophene-2-carboxamide
Chemical Structure Depiction of
N-[2-(3-chlorophenyl)ethyl]-5-(4-ethoxyphenyl)thiophene-2-carboxamide
N-[2-(3-chlorophenyl)ethyl]-5-(4-ethoxyphenyl)thiophene-2-carboxamide
Compound characteristics
| Compound ID: | V003-6728 |
| Compound Name: | N-[2-(3-chlorophenyl)ethyl]-5-(4-ethoxyphenyl)thiophene-2-carboxamide |
| Molecular Weight: | 385.91 |
| Molecular Formula: | C21 H20 Cl N O2 S |
| Smiles: | CCOc1ccc(cc1)c1ccc(C(NCCc2cccc(c2)[Cl])=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 5.5823 |
| logD: | 5.5823 |
| logSw: | -5.9124 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.364 |
| InChI Key: | UAIQDHGTDMWURM-UHFFFAOYSA-N |