2-[(2-chloro-4-fluorophenyl)methyl]-4-({[3-(trifluoromethyl)phenyl]sulfanyl}methyl)-1,3-thiazole
Chemical Structure Depiction of
2-[(2-chloro-4-fluorophenyl)methyl]-4-({[3-(trifluoromethyl)phenyl]sulfanyl}methyl)-1,3-thiazole
2-[(2-chloro-4-fluorophenyl)methyl]-4-({[3-(trifluoromethyl)phenyl]sulfanyl}methyl)-1,3-thiazole
Compound characteristics
| Compound ID: | V003-6730 |
| Compound Name: | 2-[(2-chloro-4-fluorophenyl)methyl]-4-({[3-(trifluoromethyl)phenyl]sulfanyl}methyl)-1,3-thiazole |
| Molecular Weight: | 417.87 |
| Molecular Formula: | C18 H12 Cl F4 N S2 |
| Smiles: | C(c1ccc(cc1[Cl])F)c1nc(CSc2cccc(c2)C(F)(F)F)cs1 |
| Stereo: | ACHIRAL |
| logP: | 6.9921 |
| logD: | 6.9921 |
| logSw: | -7.0074 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 10.6913 |
| InChI Key: | SNDKSFXJTUQNCW-UHFFFAOYSA-N |