N-cyclohexyl-3-(4-fluorophenyl)-8-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxamide
Chemical Structure Depiction of
N-cyclohexyl-3-(4-fluorophenyl)-8-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxamide
N-cyclohexyl-3-(4-fluorophenyl)-8-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxamide
Compound characteristics
| Compound ID: | V003-7331 |
| Compound Name: | N-cyclohexyl-3-(4-fluorophenyl)-8-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxamide |
| Molecular Weight: | 475.53 |
| Molecular Formula: | C26 H29 F4 N3 O |
| Salt: | not_available |
| Smiles: | C1CCC(CC1)NC(C1Cc2cc(ccc2N2CCN(CC12)c1ccc(cc1)F)C(F)(F)F)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.9248 |
| logD: | 5.9247 |
| logSw: | -5.8554 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.9421 |
| InChI Key: | AAOHIBRDXCTULO-UHFFFAOYSA-N |