2-fluoro-N-{3-[3-(3-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
Chemical Structure Depiction of
2-fluoro-N-{3-[3-(3-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
2-fluoro-N-{3-[3-(3-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
Compound characteristics
| Compound ID: | V003-7423 |
| Compound Name: | 2-fluoro-N-{3-[3-(3-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide |
| Molecular Weight: | 422.48 |
| Molecular Formula: | C23 H19 F N2 O3 S |
| Smiles: | COc1cccc(c1)N1C(c2cccc(c2)NC(c2ccccc2F)=O)SCC1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3414 |
| logD: | 4.34 |
| logSw: | -4.4692 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.768 |
| InChI Key: | NFSDJQVEUMYJAY-QHCPKHFHSA-N |