ethyl 4-(4-fluorophenyl)-1-methyl-2-oxo-6-[(2,3,5-trimethylphenoxy)methyl]-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Chemical Structure Depiction of
ethyl 4-(4-fluorophenyl)-1-methyl-2-oxo-6-[(2,3,5-trimethylphenoxy)methyl]-1,2,3,4-tetrahydropyrimidine-5-carboxylate
ethyl 4-(4-fluorophenyl)-1-methyl-2-oxo-6-[(2,3,5-trimethylphenoxy)methyl]-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | V003-8284 |
| Compound Name: | ethyl 4-(4-fluorophenyl)-1-methyl-2-oxo-6-[(2,3,5-trimethylphenoxy)methyl]-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Molecular Weight: | 426.49 |
| Molecular Formula: | C24 H27 F N2 O4 |
| Smiles: | CCOC(C1C(c2ccc(cc2)F)NC(N(C)C=1COc1cc(C)cc(C)c1C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.828 |
| logD: | 4.8139 |
| logSw: | -4.4874 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.104 |
| InChI Key: | XYFPPIABMNDHCY-QFIPXVFZSA-N |