methyl 4-{4-[2-(4-chlorophenyl)-2-{[4-(trifluoromethyl)phenyl]methoxy}ethyl]piperazin-1-yl}-4-oxobutanoate
Chemical Structure Depiction of
methyl 4-{4-[2-(4-chlorophenyl)-2-{[4-(trifluoromethyl)phenyl]methoxy}ethyl]piperazin-1-yl}-4-oxobutanoate
methyl 4-{4-[2-(4-chlorophenyl)-2-{[4-(trifluoromethyl)phenyl]methoxy}ethyl]piperazin-1-yl}-4-oxobutanoate
Compound characteristics
| Compound ID: | V003-8536 |
| Compound Name: | methyl 4-{4-[2-(4-chlorophenyl)-2-{[4-(trifluoromethyl)phenyl]methoxy}ethyl]piperazin-1-yl}-4-oxobutanoate |
| Molecular Weight: | 512.96 |
| Molecular Formula: | C25 H28 Cl F3 N2 O4 |
| Salt: | not_available |
| Smiles: | COC(CCC(N1CCN(CC1)CC(c1ccc(cc1)[Cl])OCc1ccc(cc1)C(F)(F)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8529 |
| logD: | 3.8469 |
| logSw: | -4.735 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 47.631 |
| InChI Key: | NWBINFAQTVYJCN-QFIPXVFZSA-N |