N-benzyl-4-[7-(trifluoromethyl)dibenzo[b,f][1,4]oxazepin-11-yl]piperazine-1-carboxamide
Chemical Structure Depiction of
N-benzyl-4-[7-(trifluoromethyl)dibenzo[b,f][1,4]oxazepin-11-yl]piperazine-1-carboxamide
N-benzyl-4-[7-(trifluoromethyl)dibenzo[b,f][1,4]oxazepin-11-yl]piperazine-1-carboxamide
Compound characteristics
| Compound ID: | V003-9344 |
| Compound Name: | N-benzyl-4-[7-(trifluoromethyl)dibenzo[b,f][1,4]oxazepin-11-yl]piperazine-1-carboxamide |
| Molecular Weight: | 480.49 |
| Molecular Formula: | C26 H23 F3 N4 O2 |
| Salt: | not_available |
| Smiles: | C(c1ccccc1)NC(N1CCN(CC1)C1c2ccccc2Oc2cc(ccc2N=1)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5444 |
| logD: | 3.8186 |
| logSw: | -4.4804 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.861 |
| InChI Key: | PDJIHZARGKRJEE-UHFFFAOYSA-N |