(3-methoxyphenyl){4-[2-methyl-8-(trifluoromethyl)dibenzo[b,f][1,4]oxazepin-11-yl]piperazin-1-yl}methanone
Chemical Structure Depiction of
(3-methoxyphenyl){4-[2-methyl-8-(trifluoromethyl)dibenzo[b,f][1,4]oxazepin-11-yl]piperazin-1-yl}methanone
(3-methoxyphenyl){4-[2-methyl-8-(trifluoromethyl)dibenzo[b,f][1,4]oxazepin-11-yl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | V003-9416 |
| Compound Name: | (3-methoxyphenyl){4-[2-methyl-8-(trifluoromethyl)dibenzo[b,f][1,4]oxazepin-11-yl]piperazin-1-yl}methanone |
| Molecular Weight: | 495.5 |
| Molecular Formula: | C27 H24 F3 N3 O3 |
| Salt: | not_available |
| Smiles: | Cc1ccc2c(c1)C(=Nc1cc(ccc1O2)C(F)(F)F)N1CCN(CC1)C(c1cccc(c1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8837 |
| logD: | 4.1851 |
| logSw: | -4.6657 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 42.262 |
| InChI Key: | TWRZZQLKCYMFDE-UHFFFAOYSA-N |