3-(3-{4-[(but-3-en-1-yl)oxy]-3-methoxyphenyl}-5-oxo-2,5-dihydro-1,2,4-triazin-6-yl)-N-[2-(pyridin-2-yl)ethyl]propanamide
Chemical Structure Depiction of
3-(3-{4-[(but-3-en-1-yl)oxy]-3-methoxyphenyl}-5-oxo-2,5-dihydro-1,2,4-triazin-6-yl)-N-[2-(pyridin-2-yl)ethyl]propanamide
3-(3-{4-[(but-3-en-1-yl)oxy]-3-methoxyphenyl}-5-oxo-2,5-dihydro-1,2,4-triazin-6-yl)-N-[2-(pyridin-2-yl)ethyl]propanamide
Compound characteristics
| Compound ID: | V003-9477 |
| Compound Name: | 3-(3-{4-[(but-3-en-1-yl)oxy]-3-methoxyphenyl}-5-oxo-2,5-dihydro-1,2,4-triazin-6-yl)-N-[2-(pyridin-2-yl)ethyl]propanamide |
| Molecular Weight: | 449.51 |
| Molecular Formula: | C24 H27 N5 O4 |
| Salt: | not_available |
| Smiles: | COc1cc(ccc1OCCC=C)C1NN=C(CCC(NCCc2ccccn2)=O)C(N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.501 |
| logD: | 1.501 |
| logSw: | -2.1134 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 95.299 |
| InChI Key: | RKQBGRBJWDXTBC-UHFFFAOYSA-N |