N-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)-3,4-dihydroisoquinoline-2(1H)-carboxamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)-3,4-dihydroisoquinoline-2(1H)-carboxamide
N-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)-3,4-dihydroisoquinoline-2(1H)-carboxamide
Compound characteristics
| Compound ID: | V004-0477 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)-3,4-dihydroisoquinoline-2(1H)-carboxamide |
| Molecular Weight: | 406.46 |
| Molecular Formula: | C24 H23 F N2 O3 |
| Smiles: | COc1cc(cc(c1)OC)NC(N1CCc2ccccc2C1c1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4015 |
| logD: | 5.4015 |
| logSw: | -5.3854 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.77 |
| InChI Key: | FSDTWQXEQRUUIC-QHCPKHFHSA-N |