N-(4-{3-(2-methoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}phenyl)thiophene-2-carboxamide
Chemical Structure Depiction of
N-(4-{3-(2-methoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}phenyl)thiophene-2-carboxamide
N-(4-{3-(2-methoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}phenyl)thiophene-2-carboxamide
Compound characteristics
| Compound ID: | V004-1217 |
| Compound Name: | N-(4-{3-(2-methoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}phenyl)thiophene-2-carboxamide |
| Molecular Weight: | 488.49 |
| Molecular Formula: | C23 H19 F3 N4 O3 S |
| Salt: | not_available |
| Smiles: | COCCOc1nc(c2cccc(c2)C(F)(F)F)n(c2ccc(cc2)NC(c2cccs2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.9108 |
| logD: | 4.9108 |
| logSw: | -4.7124 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.56 |
| InChI Key: | VQJWOWQOLWLRIW-UHFFFAOYSA-N |