N'-tert-butyl-N-({5-[(2,5-dimethylphenyl)methyl]-4-methyl-6-oxo-1,6-dihydropyrimidin-2-yl}methyl)-N-[(furan-2-yl)methyl]urea
Chemical Structure Depiction of
N'-tert-butyl-N-({5-[(2,5-dimethylphenyl)methyl]-4-methyl-6-oxo-1,6-dihydropyrimidin-2-yl}methyl)-N-[(furan-2-yl)methyl]urea
N'-tert-butyl-N-({5-[(2,5-dimethylphenyl)methyl]-4-methyl-6-oxo-1,6-dihydropyrimidin-2-yl}methyl)-N-[(furan-2-yl)methyl]urea
Compound characteristics
| Compound ID: | V004-1221 |
| Compound Name: | N'-tert-butyl-N-({5-[(2,5-dimethylphenyl)methyl]-4-methyl-6-oxo-1,6-dihydropyrimidin-2-yl}methyl)-N-[(furan-2-yl)methyl]urea |
| Molecular Weight: | 436.55 |
| Molecular Formula: | C25 H32 N4 O3 |
| Salt: | not_available |
| Smiles: | CC1=C(Cc2cc(C)ccc2C)C(NC(CN(Cc2ccco2)C(NC(C)(C)C)=O)=N1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5993 |
| logD: | 4.5983 |
| logSw: | -4.3583 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.479 |
| InChI Key: | RLWBONLDWMMADN-UHFFFAOYSA-N |