4-(4-{[N-acetyl-N-(propan-2-yl)glycyl]amino}phenyl)-N-(2-fluorophenyl)piperazine-1-carboxamide
Chemical Structure Depiction of
4-(4-{[N-acetyl-N-(propan-2-yl)glycyl]amino}phenyl)-N-(2-fluorophenyl)piperazine-1-carboxamide
4-(4-{[N-acetyl-N-(propan-2-yl)glycyl]amino}phenyl)-N-(2-fluorophenyl)piperazine-1-carboxamide
Compound characteristics
| Compound ID: | V004-1971 |
| Compound Name: | 4-(4-{[N-acetyl-N-(propan-2-yl)glycyl]amino}phenyl)-N-(2-fluorophenyl)piperazine-1-carboxamide |
| Molecular Weight: | 455.53 |
| Molecular Formula: | C24 H30 F N5 O3 |
| Salt: | not_available |
| Smiles: | CC(C)N(CC(Nc1ccc(cc1)N1CCN(CC1)C(Nc1ccccc1F)=O)=O)C(C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0451 |
| logD: | 3.0389 |
| logSw: | -3.1931 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.114 |
| InChI Key: | XZDYWSLAVKXGLR-UHFFFAOYSA-N |