N-{[5-(2,4-difluorophenoxy)-3-ethyl-1-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl}-N-[(oxolan-2-yl)methyl]cyclobutanecarboxamide
Chemical Structure Depiction of
N-{[5-(2,4-difluorophenoxy)-3-ethyl-1-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl}-N-[(oxolan-2-yl)methyl]cyclobutanecarboxamide
N-{[5-(2,4-difluorophenoxy)-3-ethyl-1-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl}-N-[(oxolan-2-yl)methyl]cyclobutanecarboxamide
Compound characteristics
| Compound ID: | V004-2104 |
| Compound Name: | N-{[5-(2,4-difluorophenoxy)-3-ethyl-1-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl}-N-[(oxolan-2-yl)methyl]cyclobutanecarboxamide |
| Molecular Weight: | 525.6 |
| Molecular Formula: | C29 H33 F2 N3 O4 |
| Smiles: | CCc1c(CN(CC2CCCO2)C(C2CCC2)=O)c(n(c2ccc(cc2)OC)n1)Oc1ccc(cc1F)F |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7529 |
| logD: | 4.7529 |
| logSw: | -4.6111 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.356 |
| InChI Key: | DNXGFNGASYHGQF-HSZRJFAPSA-N |