2-{4-[(2,4-dichlorophenyl)methoxy]phenyl}-N-(3-methylphenyl)-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
2-{4-[(2,4-dichlorophenyl)methoxy]phenyl}-N-(3-methylphenyl)-1,3-thiazole-4-carboxamide
2-{4-[(2,4-dichlorophenyl)methoxy]phenyl}-N-(3-methylphenyl)-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | V004-2291 |
| Compound Name: | 2-{4-[(2,4-dichlorophenyl)methoxy]phenyl}-N-(3-methylphenyl)-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 469.39 |
| Molecular Formula: | C24 H18 Cl2 N2 O2 S |
| Smiles: | Cc1cccc(c1)NC(c1csc(c2ccc(cc2)OCc2ccc(cc2[Cl])[Cl])n1)=O |
| Stereo: | ACHIRAL |
| logP: | 7.3058 |
| logD: | 7.3058 |
| logSw: | -6.3921 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.291 |
| InChI Key: | VLAZPAVQEFLQOH-UHFFFAOYSA-N |