2-[3-(3,4-dimethylphenyl)-6-methyl-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl]-N-[(furan-2-yl)methyl]propanamide
Chemical Structure Depiction of
2-[3-(3,4-dimethylphenyl)-6-methyl-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl]-N-[(furan-2-yl)methyl]propanamide
2-[3-(3,4-dimethylphenyl)-6-methyl-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl]-N-[(furan-2-yl)methyl]propanamide
Compound characteristics
| Compound ID: | V004-5152 |
| Compound Name: | 2-[3-(3,4-dimethylphenyl)-6-methyl-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl]-N-[(furan-2-yl)methyl]propanamide |
| Molecular Weight: | 431.49 |
| Molecular Formula: | C25 H25 N3 O4 |
| Smiles: | CC(C(NCc1ccco1)=O)N1C(N(C(c2cc(C)ccc12)=O)c1ccc(C)c(C)c1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0453 |
| logD: | 4.0453 |
| logSw: | -4.1175 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.43 |
| InChI Key: | HHIGZEZPTXOVJX-SFHVURJKSA-N |