N~2~-[(3-fluorophenyl)carbamoyl]-N-[(4-fluorophenyl)methyl]-N~2~-(2-methylbutyl)-N-[(5-methylthiophen-2-yl)methyl]glycinamide
Chemical Structure Depiction of
N~2~-[(3-fluorophenyl)carbamoyl]-N-[(4-fluorophenyl)methyl]-N~2~-(2-methylbutyl)-N-[(5-methylthiophen-2-yl)methyl]glycinamide
N~2~-[(3-fluorophenyl)carbamoyl]-N-[(4-fluorophenyl)methyl]-N~2~-(2-methylbutyl)-N-[(5-methylthiophen-2-yl)methyl]glycinamide
Compound characteristics
| Compound ID: | V004-6961 |
| Compound Name: | N~2~-[(3-fluorophenyl)carbamoyl]-N-[(4-fluorophenyl)methyl]-N~2~-(2-methylbutyl)-N-[(5-methylthiophen-2-yl)methyl]glycinamide |
| Molecular Weight: | 499.62 |
| Molecular Formula: | C27 H31 F2 N3 O2 S |
| Smiles: | CCC(C)CN(CC(N(Cc1ccc(cc1)F)Cc1ccc(C)s1)=O)C(Nc1cccc(c1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.2779 |
| logD: | 6.2779 |
| logSw: | -5.4715 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.972 |
| InChI Key: | AQDRBVKQDWTVKB-IBGZPJMESA-N |