N-[4-(trifluoromethyl)phenyl]-4-({5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl}methyl)piperazine-1-carboxamide
Chemical Structure Depiction of
N-[4-(trifluoromethyl)phenyl]-4-({5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl}methyl)piperazine-1-carboxamide
N-[4-(trifluoromethyl)phenyl]-4-({5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl}methyl)piperazine-1-carboxamide
Compound characteristics
| Compound ID: | V004-7332 |
| Compound Name: | N-[4-(trifluoromethyl)phenyl]-4-({5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl}methyl)piperazine-1-carboxamide |
| Molecular Weight: | 499.41 |
| Molecular Formula: | C22 H19 F6 N5 O2 |
| Salt: | not_available |
| Smiles: | C1CN(CCN1Cc1nc(c2ccc(cc2)C(F)(F)F)on1)C(Nc1ccc(cc1)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5906 |
| logD: | 4.5906 |
| logSw: | -4.4605 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.916 |
| InChI Key: | RNKYTDXVVRBVSQ-UHFFFAOYSA-N |