N'-tert-butyl-N-cyclopropyl-N-{[3-methyl-5-(3-methylphenoxy)-1-phenyl-1H-pyrazol-4-yl]methyl}urea
Chemical Structure Depiction of
N'-tert-butyl-N-cyclopropyl-N-{[3-methyl-5-(3-methylphenoxy)-1-phenyl-1H-pyrazol-4-yl]methyl}urea
N'-tert-butyl-N-cyclopropyl-N-{[3-methyl-5-(3-methylphenoxy)-1-phenyl-1H-pyrazol-4-yl]methyl}urea
Compound characteristics
| Compound ID: | V004-8519 |
| Compound Name: | N'-tert-butyl-N-cyclopropyl-N-{[3-methyl-5-(3-methylphenoxy)-1-phenyl-1H-pyrazol-4-yl]methyl}urea |
| Molecular Weight: | 432.57 |
| Molecular Formula: | C26 H32 N4 O2 |
| Smiles: | Cc1cccc(c1)Oc1c(CN(C2CC2)C(NC(C)(C)C)=O)c(C)nn1c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.8417 |
| logD: | 5.8417 |
| logSw: | -5.5167 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.674 |
| InChI Key: | ZJAVPNTVXYUXGZ-UHFFFAOYSA-N |