methyl 4-[N-(furan-2-carbonyl)-N-(3-methoxypropyl)alanyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
methyl 4-[N-(furan-2-carbonyl)-N-(3-methoxypropyl)alanyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate
methyl 4-[N-(furan-2-carbonyl)-N-(3-methoxypropyl)alanyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | V004-9758 |
| Compound Name: | methyl 4-[N-(furan-2-carbonyl)-N-(3-methoxypropyl)alanyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 390.44 |
| Molecular Formula: | C20 H26 N2 O6 |
| Smiles: | CC(C(c1c(C)c(C(=O)OC)[nH]c1C)=O)N(CCCOC)C(c1ccco1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.9737 |
| logD: | 1.9737 |
| logSw: | -2.26 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.606 |
| InChI Key: | VFZUMNSSSOIKDY-AWEZNQCLSA-N |