N-[5-amino-1-(2-chlorophenyl)-3-(4-methoxyphenyl)-1H-pyrazol-4-yl]-N'-(2-methoxyethyl)urea
Chemical Structure Depiction of
N-[5-amino-1-(2-chlorophenyl)-3-(4-methoxyphenyl)-1H-pyrazol-4-yl]-N'-(2-methoxyethyl)urea
N-[5-amino-1-(2-chlorophenyl)-3-(4-methoxyphenyl)-1H-pyrazol-4-yl]-N'-(2-methoxyethyl)urea
Compound characteristics
| Compound ID: | V005-1177 |
| Compound Name: | N-[5-amino-1-(2-chlorophenyl)-3-(4-methoxyphenyl)-1H-pyrazol-4-yl]-N'-(2-methoxyethyl)urea |
| Molecular Weight: | 415.88 |
| Molecular Formula: | C20 H22 Cl N5 O3 |
| Smiles: | COCCNC(Nc1c(c2ccc(cc2)OC)nn(c2ccccc2[Cl])c1N)=O |
| Stereo: | ACHIRAL |
| logP: | 2.547 |
| logD: | 2.547 |
| logSw: | -3.2954 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 81.757 |
| InChI Key: | CACBIOAVKRUDDS-UHFFFAOYSA-N |