3,4-dimethoxy-N-[4-methyl-3-{[5-(morpholine-4-carbonyl)furan-2-yl]methyl}-1,3-thiazol-2(3H)-ylidene]benzamide
Chemical Structure Depiction of
3,4-dimethoxy-N-[4-methyl-3-{[5-(morpholine-4-carbonyl)furan-2-yl]methyl}-1,3-thiazol-2(3H)-ylidene]benzamide
3,4-dimethoxy-N-[4-methyl-3-{[5-(morpholine-4-carbonyl)furan-2-yl]methyl}-1,3-thiazol-2(3H)-ylidene]benzamide
Compound characteristics
| Compound ID: | V005-2064 |
| Compound Name: | 3,4-dimethoxy-N-[4-methyl-3-{[5-(morpholine-4-carbonyl)furan-2-yl]methyl}-1,3-thiazol-2(3H)-ylidene]benzamide |
| Molecular Weight: | 471.53 |
| Molecular Formula: | C23 H25 N3 O6 S |
| Smiles: | CC1=CSC(=N/C(c2ccc(c(c2)OC)OC)=O)\N1Cc1ccc(C(N2CCOCC2)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 2.0876 |
| logD: | 2.0876 |
| logSw: | -2.7405 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 73.004 |
| InChI Key: | ONYJHJMFBXUBLH-UHFFFAOYSA-N |