2-chloro-N-{[2-(dimethylamino)-5-(2-methylpropanamido)phenyl]methyl}-N-(3-methylbutan-2-yl)benzamide
Chemical Structure Depiction of
2-chloro-N-{[2-(dimethylamino)-5-(2-methylpropanamido)phenyl]methyl}-N-(3-methylbutan-2-yl)benzamide
2-chloro-N-{[2-(dimethylamino)-5-(2-methylpropanamido)phenyl]methyl}-N-(3-methylbutan-2-yl)benzamide
Compound characteristics
| Compound ID: | V005-4675 |
| Compound Name: | 2-chloro-N-{[2-(dimethylamino)-5-(2-methylpropanamido)phenyl]methyl}-N-(3-methylbutan-2-yl)benzamide |
| Molecular Weight: | 444.02 |
| Molecular Formula: | C25 H34 Cl N3 O2 |
| Salt: | not_available |
| Smiles: | CC(C)C(C)N(Cc1cc(ccc1N(C)C)NC(C(C)C)=O)C(c1ccccc1[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.7842 |
| logD: | 5.7736 |
| logSw: | -5.7346 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.68 |
| InChI Key: | QKWVJHKUOUVADU-SFHVURJKSA-N |