ethyl 4-[N-cyclohexyl-N-(4-fluorobenzene-1-sulfonyl)glycyl]-1,3,5-trimethyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
ethyl 4-[N-cyclohexyl-N-(4-fluorobenzene-1-sulfonyl)glycyl]-1,3,5-trimethyl-1H-pyrrole-2-carboxylate
ethyl 4-[N-cyclohexyl-N-(4-fluorobenzene-1-sulfonyl)glycyl]-1,3,5-trimethyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | V005-4945 |
| Compound Name: | ethyl 4-[N-cyclohexyl-N-(4-fluorobenzene-1-sulfonyl)glycyl]-1,3,5-trimethyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 478.58 |
| Molecular Formula: | C24 H31 F N2 O5 S |
| Smiles: | CCOC(c1c(C)c(C(CN(C2CCCCC2)S(c2ccc(cc2)F)(=O)=O)=O)c(C)n1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2039 |
| logD: | 4.2039 |
| logSw: | -4.2339 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 67.434 |
| InChI Key: | VEHQBXXIOAWAPL-UHFFFAOYSA-N |