4-tert-butyl-N'-[(3-methoxyphenyl)methylidene]benzohydrazide
Chemical Structure Depiction of
4-tert-butyl-N'-[(3-methoxyphenyl)methylidene]benzohydrazide
4-tert-butyl-N'-[(3-methoxyphenyl)methylidene]benzohydrazide
Compound characteristics
| Compound ID: | V005-6937 |
| Compound Name: | 4-tert-butyl-N'-[(3-methoxyphenyl)methylidene]benzohydrazide |
| Molecular Weight: | 310.39 |
| Molecular Formula: | C19 H22 N2 O2 |
| Smiles: | CC(C)(C)c1ccc(cc1)C(N/N=C/c1cccc(c1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8819 |
| logD: | 4.8766 |
| logSw: | -4.6397 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.098 |
| InChI Key: | HWIWNDOYDDSPGK-UHFFFAOYSA-N |