N-({2-[(2,6-dimethoxyphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-2-fluoro-N-[2-(morpholin-4-yl)ethyl]benzamide
Chemical Structure Depiction of
N-({2-[(2,6-dimethoxyphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-2-fluoro-N-[2-(morpholin-4-yl)ethyl]benzamide
N-({2-[(2,6-dimethoxyphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-2-fluoro-N-[2-(morpholin-4-yl)ethyl]benzamide
Compound characteristics
| Compound ID: | V005-7182 |
| Compound Name: | N-({2-[(2,6-dimethoxyphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-2-fluoro-N-[2-(morpholin-4-yl)ethyl]benzamide |
| Molecular Weight: | 515.6 |
| Molecular Formula: | C26 H30 F N3 O5 S |
| Salt: | not_available |
| Smiles: | COc1cccc(c1OCc1nc(CN(CCN2CCOCC2)C(c2ccccc2F)=O)cs1)OC |
| Stereo: | ACHIRAL |
| logP: | 2.958 |
| logD: | 2.9518 |
| logSw: | -3.3724 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 61.705 |
| InChI Key: | YNJCWTZILSYTSY-UHFFFAOYSA-N |