6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine
Chemical Structure Depiction of
6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine
6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine
Compound characteristics
| Compound ID: | V005-8360 |
| Compound Name: | 6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine |
| Molecular Weight: | 388.28 |
| Molecular Formula: | C19 H19 Br F N3 |
| Salt: | not_available |
| Smiles: | C1CCC(CC1)Nc1c(c2cccc(c2)F)nc2ccc(cn12)[Br] |
| Stereo: | ACHIRAL |
| logP: | 5.8205 |
| logD: | 5.8005 |
| logSw: | -5.9846 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 18.6194 |
| InChI Key: | ZFMMNOGPVYDBCF-UHFFFAOYSA-N |