N,N-diethyl-2-[4-(furan-2-carbonyl)piperazin-1-yl]-5-(4-methoxybenzamido)benzamide
Chemical Structure Depiction of
N,N-diethyl-2-[4-(furan-2-carbonyl)piperazin-1-yl]-5-(4-methoxybenzamido)benzamide
N,N-diethyl-2-[4-(furan-2-carbonyl)piperazin-1-yl]-5-(4-methoxybenzamido)benzamide
Compound characteristics
| Compound ID: | V005-8405 |
| Compound Name: | N,N-diethyl-2-[4-(furan-2-carbonyl)piperazin-1-yl]-5-(4-methoxybenzamido)benzamide |
| Molecular Weight: | 504.59 |
| Molecular Formula: | C28 H32 N4 O5 |
| Salt: | not_available |
| Smiles: | CCN(CC)C(c1cc(ccc1N1CCN(CC1)C(c1ccco1)=O)NC(c1ccc(cc1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2207 |
| logD: | 3.2207 |
| logSw: | -3.5876 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.992 |
| InChI Key: | JYEKVSSDQOTZDB-UHFFFAOYSA-N |