(2,5-difluorophenyl)[1-(4-fluorophenyl)-6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl]methanone
Chemical Structure Depiction of
(2,5-difluorophenyl)[1-(4-fluorophenyl)-6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl]methanone
(2,5-difluorophenyl)[1-(4-fluorophenyl)-6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl]methanone
Compound characteristics
| Compound ID: | V005-8733 |
| Compound Name: | (2,5-difluorophenyl)[1-(4-fluorophenyl)-6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl]methanone |
| Molecular Weight: | 427.42 |
| Molecular Formula: | C24 H20 F3 N O3 |
| Smiles: | COc1cc2CCN(C(c3ccc(cc3)F)c2cc1OC)C(c1cc(ccc1F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6371 |
| logD: | 4.6371 |
| logSw: | -4.4988 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.1221 |
| InChI Key: | ROKKQZGVNXGTQU-QHCPKHFHSA-N |