N-{2-[5-(2H-1,3-benzodioxol-5-yl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-[2-(morpholin-4-yl)ethyl]thiophene-2-carboxamide
Chemical Structure Depiction of
N-{2-[5-(2H-1,3-benzodioxol-5-yl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-[2-(morpholin-4-yl)ethyl]thiophene-2-carboxamide
N-{2-[5-(2H-1,3-benzodioxol-5-yl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-[2-(morpholin-4-yl)ethyl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | V005-9255 |
| Compound Name: | N-{2-[5-(2H-1,3-benzodioxol-5-yl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-[2-(morpholin-4-yl)ethyl]thiophene-2-carboxamide |
| Molecular Weight: | 564.64 |
| Molecular Formula: | C29 H29 F N4 O5 S |
| Salt: | not_available |
| Smiles: | C1C(c2ccc3c(c2)OCO3)N(C(CN(CCN2CCOCC2)C(c2cccs2)=O)=O)N=C1c1ccccc1F |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7962 |
| logD: | 3.7867 |
| logSw: | -4.0132 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 72.801 |
| InChI Key: | LKBZIEDBZVADFK-DEOSSOPVSA-N |