1-(dibenzylamino)-3-(2-methylpropoxy)propan-2-ol
Chemical Structure Depiction of
1-(dibenzylamino)-3-(2-methylpropoxy)propan-2-ol
1-(dibenzylamino)-3-(2-methylpropoxy)propan-2-ol
Compound characteristics
| Compound ID: | V005-9893 |
| Compound Name: | 1-(dibenzylamino)-3-(2-methylpropoxy)propan-2-ol |
| Molecular Weight: | 327.47 |
| Molecular Formula: | C21 H29 N O2 |
| Smiles: | CC(C)COCC(CN(Cc1ccccc1)Cc1ccccc1)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0102 |
| logD: | 3.933 |
| logSw: | -4.0616 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.0039 |
| InChI Key: | KHPQQPJNLSTZEW-NRFANRHFSA-N |