4-({[(4-fluorophenyl)methyl](furan-2-carbonyl)amino}methyl)phenyl 3-(trifluoromethyl)benzene-1-sulfonate
Chemical Structure Depiction of
4-({[(4-fluorophenyl)methyl](furan-2-carbonyl)amino}methyl)phenyl 3-(trifluoromethyl)benzene-1-sulfonate
4-({[(4-fluorophenyl)methyl](furan-2-carbonyl)amino}methyl)phenyl 3-(trifluoromethyl)benzene-1-sulfonate
Compound characteristics
| Compound ID: | V006-3655 |
| Compound Name: | 4-({[(4-fluorophenyl)methyl](furan-2-carbonyl)amino}methyl)phenyl 3-(trifluoromethyl)benzene-1-sulfonate |
| Molecular Weight: | 533.5 |
| Molecular Formula: | C26 H19 F4 N O5 S |
| Smiles: | C(c1ccc(cc1)OS(c1cccc(c1)C(F)(F)F)(=O)=O)N(Cc1ccc(cc1)F)C(c1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1262 |
| logD: | 5.1262 |
| logSw: | -5.5482 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 60.518 |
| InChI Key: | SDSYSVHDLCSKNK-UHFFFAOYSA-N |