N-(2-{[(2H-1,3-benzodioxol-5-yl)methyl][(furan-2-yl)methyl]amino}-2-oxoethyl)-N-[3-(morpholin-4-yl)propyl]hexanamide
Chemical Structure Depiction of
N-(2-{[(2H-1,3-benzodioxol-5-yl)methyl][(furan-2-yl)methyl]amino}-2-oxoethyl)-N-[3-(morpholin-4-yl)propyl]hexanamide
N-(2-{[(2H-1,3-benzodioxol-5-yl)methyl][(furan-2-yl)methyl]amino}-2-oxoethyl)-N-[3-(morpholin-4-yl)propyl]hexanamide
Compound characteristics
| Compound ID: | V006-4139 |
| Compound Name: | N-(2-{[(2H-1,3-benzodioxol-5-yl)methyl][(furan-2-yl)methyl]amino}-2-oxoethyl)-N-[3-(morpholin-4-yl)propyl]hexanamide |
| Molecular Weight: | 513.63 |
| Molecular Formula: | C28 H39 N3 O6 |
| Salt: | not_available |
| Smiles: | CCCCCC(N(CCCN1CCOCC1)CC(N(Cc1ccc2c(c1)OCO2)Cc1ccco1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2807 |
| logD: | 3.0978 |
| logSw: | -3.2071 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 68.339 |
| InChI Key: | BLFOKTRMHXJKPX-UHFFFAOYSA-N |